C14H11N5O3S — CID 71296853
4-[[2-(7H-purin-6-ylsulfanyl)acetyl]amino]benzoic acid (PubChem CID 71296853) has the molecular formula C14H11N5O3S and a molecular weight of 329.34 g/mol. Its IUPAC name is 4-[[2-(7H-purin-6-ylsulfanyl)acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(7H-purin-6-ylsulfanyl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 71296853 |
| Molecular Formula | C14H11N5O3S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-[[2-(7H-purin-6-ylsulfanyl)acetyl]amino]benzoic acid |
| SMILES | O=C(CSc1ncnc2nc[nH]c12)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H11N5O3S/c20-10(19-9-3-1-8(2-4-9)14(21)22)5-23-13-11-12(16-6-15-11)17-7-18-13/h1-4,6-7H,5H2,(H,19,20)(H,21,22)(H,15,16,17,18) |
| InChIKey | GCOCVJYQPZIKHQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |