C13H9IN4OS — CID 62253611
1-(4-iodophenyl)-2-(7H-purin-6-ylsulfanyl)ethanone (PubChem CID 62253611) has the molecular formula C13H9IN4OS and a molecular weight of 396.21 g/mol. Its IUPAC name is 1-(4-iodophenyl)-2-(7H-purin-6-ylsulfanyl)ethanone.
| Compound Name | 1-(4-iodophenyl)-2-(7H-purin-6-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 62253611 |
| Molecular Formula | C13H9IN4OS |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 1-(4-iodophenyl)-2-(7H-purin-6-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1ncnc2nc[nH]c12)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H9IN4OS/c14-9-3-1-8(2-4-9)10(19)5-20-13-11-12(16-6-15-11)17-7-18-13/h1-4,6-7H,5H2,(H,15,16,17,18) |
| InChIKey | QJGUPIUFRAXVKX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|