C13H12N4OS2 — CID 62253798
1-(2,5-dimethylthiophen-3-yl)-2-(7H-purin-6-ylsulfanyl)ethanone (PubChem CID 62253798) has the molecular formula C13H12N4OS2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-2-(7H-purin-6-ylsulfanyl)ethanone.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-2-(7H-purin-6-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 62253798 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-2-(7H-purin-6-ylsulfanyl)ethanone |
| SMILES | Cc1cc(C(=O)CSc2ncnc3nc[nH]c23)c(C)s1 |
| InChI | InChI=1S/C13H12N4OS2/c1-7-3-9(8(2)20-7)10(18)4-19-13-11-12(15-5-14-11)16-6-17-13/h3,5-6H,4H2,1-2H3,(H,14,15,16,17) |
| InChIKey | LAROVZLSMIUZOI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |