C14H14N8S2 — CID 3844803
6-[4-(7H-purin-6-ylsulfanyl)butylsulfanyl]-7H-purine (PubChem CID 3844803) has the molecular formula C14H14N8S2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 6-[4-(7H-purin-6-ylsulfanyl)butylsulfanyl]-7H-purine.
| Compound Name | 6-[4-(7H-purin-6-ylsulfanyl)butylsulfanyl]-7H-purine |
|---|---|
| PubChem CID | 3844803 |
| Molecular Formula | C14H14N8S2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 6-[4-(7H-purin-6-ylsulfanyl)butylsulfanyl]-7H-purine |
| SMILES | c1nc(SCCCCSc2ncnc3nc[nH]c23)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H14N8S2/c1(3-23-13-9-11(17-5-15-9)19-7-21-13)2-4-24-14-10-12(18-6-16-10)20-8-22-14/h5-8H,1-4H2,(H,15,17,19,21)(H,16,18,20,22) |
| InChIKey | VGBSJHYGAMSHSN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|