C12H18N6OS — CID 62254165
2-amino-2-methyl-6-(7H-purin-6-ylsulfanyl)hexanamide (PubChem CID 62254165) has the molecular formula C12H18N6OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-amino-2-methyl-6-(7H-purin-6-ylsulfanyl)hexanamide.
| Compound Name | 2-amino-2-methyl-6-(7H-purin-6-ylsulfanyl)hexanamide |
|---|---|
| PubChem CID | 62254165 |
| Molecular Formula | C12H18N6OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-amino-2-methyl-6-(7H-purin-6-ylsulfanyl)hexanamide |
| SMILES | CC(N)(CCCCSc1ncnc2nc[nH]c12)C(N)=O |
| InChI | InChI=1S/C12H18N6OS/c1-12(14,11(13)19)4-2-3-5-20-10-8-9(16-6-15-8)17-7-18-10/h6-7H,2-5,14H2,1H3,(H2,13,19)(H,15,16,17,18) |
| InChIKey | SKJUDWQOPLGRLF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|