C12H17N5O2S — CID 62254340
methyl 2-methyl-2-(methylamino)-4-(7H-purin-6-ylsulfanyl)butanoate (PubChem CID 62254340) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is methyl 2-methyl-2-(methylamino)-4-(7H-purin-6-ylsulfanyl)butanoate.
| Compound Name | methyl 2-methyl-2-(methylamino)-4-(7H-purin-6-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 62254340 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | methyl 2-methyl-2-(methylamino)-4-(7H-purin-6-ylsulfanyl)butanoate |
| SMILES | CNC(C)(CCSc1ncnc2nc[nH]c12)C(=O)OC |
| InChI | InChI=1S/C12H17N5O2S/c1-12(13-2,11(18)19-3)4-5-20-10-8-9(15-6-14-8)16-7-17-10/h6-7,13H,4-5H2,1-3H3,(H,14,15,16,17) |
| InChIKey | LMHJVKZPMIWLDQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |