C8H11N5S — CID 62255575
N-methyl-2-(7H-purin-6-ylsulfanyl)ethanamine (PubChem CID 62255575) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is N-methyl-2-(7H-purin-6-ylsulfanyl)ethanamine.
| Compound Name | N-methyl-2-(7H-purin-6-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 62255575 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-methyl-2-(7H-purin-6-ylsulfanyl)ethanamine |
| SMILES | CNCCSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C8H11N5S/c1-9-2-3-14-8-6-7(11-4-10-6)12-5-13-8/h4-5,9H,2-3H2,1H3,(H,10,11,12,13) |
| InChIKey | NWHNPQFYCUWAES-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|