C13H19N5O2S — CID 62253999
2-methyl-2-(methylamino)-6-(7H-purin-6-ylsulfanyl)hexanoic acid (PubChem CID 62253999) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-6-(7H-purin-6-ylsulfanyl)hexanoic acid.
| Compound Name | 2-methyl-2-(methylamino)-6-(7H-purin-6-ylsulfanyl)hexanoic acid |
|---|---|
| PubChem CID | 62253999 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-methyl-2-(methylamino)-6-(7H-purin-6-ylsulfanyl)hexanoic acid |
| SMILES | CNC(C)(CCCCSc1ncnc2nc[nH]c12)C(=O)O |
| InChI | InChI=1S/C13H19N5O2S/c1-13(14-2,12(19)20)5-3-4-6-21-11-9-10(16-7-15-9)17-8-18-11/h7-8,14H,3-6H2,1-2H3,(H,19,20)(H,15,16,17,18) |
| InChIKey | FOUIDMHCKJJQAY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|