C9H11N7O2S — CID 522954
1-methyl-1-nitroso-3-[2-(7H-purin-6-ylsulfanyl)ethyl]urea (PubChem CID 522954) has the molecular formula C9H11N7O2S and a molecular weight of 281.30 g/mol. Its IUPAC name is 1-methyl-1-nitroso-3-[2-(7H-purin-6-ylsulfanyl)ethyl]urea.
| Compound Name | 1-methyl-1-nitroso-3-[2-(7H-purin-6-ylsulfanyl)ethyl]urea |
|---|---|
| PubChem CID | 522954 |
| Molecular Formula | C9H11N7O2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1-methyl-1-nitroso-3-[2-(7H-purin-6-ylsulfanyl)ethyl]urea |
| SMILES | CN(N=O)C(=O)NCCSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C9H11N7O2S/c1-16(15-18)9(17)10-2-3-19-8-6-7(12-4-11-6)13-5-14-8/h4-5H,2-3H2,1H3,(H,10,17)(H,11,12,13,14) |
| InChIKey | KNBAVCNFOCPHPD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|