C16H12Cl2N4OS — CID 51698889
1-[3-[(1S)-2,2-dichlorocyclopropyl]phenyl]-2-(7H-purin-6-ylsulfanyl)ethanone (PubChem CID 51698889) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is 1-[3-[(1S)-2,2-dichlorocyclopropyl]phenyl]-2-(7H-purin-6-ylsulfanyl)ethanone.
| Compound Name | 1-[3-[(1S)-2,2-dichlorocyclopropyl]phenyl]-2-(7H-purin-6-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 51698889 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1-[3-[(1S)-2,2-dichlorocyclopropyl]phenyl]-2-(7H-purin-6-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1ncnc2nc[nH]c12)c1cccc([C@@H]2CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N4OS/c17-16(18)5-11(16)9-2-1-3-10(4-9)12(23)6-24-15-13-14(20-7-19-13)21-8-22-15/h1-4,7-8,11H,5-6H2,(H,19,20,21,22)/t11-/m0/s1 |
| InChIKey | YROFXORRRUEAGE-NSHDSACASA-N |
| XLogP | 3.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|