C9H7ClN4OS2 — CID 2471414
N-(2-chloro-3-pyridinyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide (PubChem CID 2471414) has the molecular formula C9H7ClN4OS2 and a molecular weight of 286.77 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 2471414 |
| Molecular Formula | C9H7ClN4OS2 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nncs1)Nc1cccnc1Cl |
| InChI | InChI=1S/C9H7ClN4OS2/c10-8-6(2-1-3-11-8)13-7(15)4-16-9-14-12-5-17-9/h1-3,5H,4H2,(H,13,15) |
| InChIKey | VNNNGANJKYGJRT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|