C17H15N3OS2 — CID 7474594
N-(2-benzylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide (PubChem CID 7474594) has the molecular formula C17H15N3OS2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(2-benzylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 7474594 |
| Molecular Formula | C17H15N3OS2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-(2-benzylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nncs1)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C17H15N3OS2/c21-16(11-22-17-20-18-12-23-17)19-15-9-5-4-8-14(15)10-13-6-2-1-3-7-13/h1-9,12H,10-11H2,(H,19,21) |
| InChIKey | KVIASJYUJZQJTB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |