C13H11Cl2N3OS — CID 79149350
2-(4-amino-3-chlorophenyl)sulfanyl-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 79149350) has the molecular formula C13H11Cl2N3OS and a molecular weight of 328.22 g/mol. Its IUPAC name is 2-(4-amino-3-chlorophenyl)sulfanyl-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-(4-amino-3-chlorophenyl)sulfanyl-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 79149350 |
| Molecular Formula | C13H11Cl2N3OS |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 2-(4-amino-3-chlorophenyl)sulfanyl-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | Nc1ccc(SCC(=O)Nc2cccnc2Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2N3OS/c14-9-6-8(3-4-10(9)16)20-7-12(19)18-11-2-1-5-17-13(11)15/h1-6H,7,16H2,(H,18,19) |
| InChIKey | CPYOFZSROMKSCY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|