2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid

C7H7N5O3 — CID 135456846

IUPAC2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid
SMILESO=C(O)CNc1nc2nc[nH]c2c(=O)[nH]1
InChIInChI=1S/C7H7N5O3/c13-3(14)1-8-7-11-5-4(6(15)12-7)9-2-10-5/h2H,1H2,(H,13,14)(H3,8,9,10,11,12,15)
InChIKeyFAPZNNPCYDCZTA-UHFFFAOYSA-N
MW209.16 g/mol
LogP-0.86
Rot. Bonds3

About 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid

2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid (PubChem CID 135456846) has the molecular formula C7H7N5O3 and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid
PubChem CID135456846
Molecular FormulaC7H7N5O3
Molecular Weight209.16 g/mol
Exact Mass209.05
IUPAC Name2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid
SMILESO=C(O)CNc1nc2nc[nH]c2c(=O)[nH]1
InChIInChI=1S/C7H7N5O3/c13-3(14)1-8-7-11-5-4(6(15)12-7)9-2-10-5/h2H,1H2,(H,13,14)(H3,8,9,10,11,12,15)
InChIKeyFAPZNNPCYDCZTA-UHFFFAOYSA-N
XLogP-0.86
TPSA123.76 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.16
LogP ≤ 5-0.86
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid?
The IUPAC name of 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid (CID 135456846) is 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid.
What is the SMILES notation for 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid?
The canonical SMILES for 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid is O=C(O)CNc1nc2nc[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid?
The InChIKey is FAPZNNPCYDCZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O3/c13-3(14)1-8-7-11-5-4(6(15)12-7)9-2-10-5/h2H,1H2,(H,13,14)(H3,8,9,10,11,12,15).
What are the key properties of 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid?
2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid has a molecular weight of 209.16 g/mol, XLogP of -0.86, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid is sourced from PubChem (CID 135456846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).