C7H7N5O3 — CID 135456846
2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid (PubChem CID 135456846) has the molecular formula C7H7N5O3 and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid.
| Compound Name | 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid |
|---|---|
| PubChem CID | 135456846 |
| Molecular Formula | C7H7N5O3 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetic acid |
| SMILES | O=C(O)CNc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N5O3/c13-3(14)1-8-7-11-5-4(6(15)12-7)9-2-10-5/h2H,1H2,(H,13,14)(H3,8,9,10,11,12,15) |
| InChIKey | FAPZNNPCYDCZTA-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |