C11H7Cl2N5O — CID 135410329
2-(3,5-dichloroanilino)-1,7-dihydropurin-6-one (PubChem CID 135410329) has the molecular formula C11H7Cl2N5O and a molecular weight of 296.12 g/mol. Its IUPAC name is 2-(3,5-dichloroanilino)-1,7-dihydropurin-6-one.
| Compound Name | 2-(3,5-dichloroanilino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135410329 |
| Molecular Formula | C11H7Cl2N5O |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 2-(3,5-dichloroanilino)-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(Nc2cc(Cl)cc(Cl)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H7Cl2N5O/c12-5-1-6(13)3-7(2-5)16-11-17-9-8(10(19)18-11)14-4-15-9/h1-4H,(H3,14,15,16,17,18,19) |
| InChIKey | XABJVTMOEMSJFI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |