C10H13N10O5P — CID 172703090
2-amino-1,7-dihydropurin-6-one;phosphoric acid;7H-purin-6-amine (PubChem CID 172703090) has the molecular formula C10H13N10O5P and a molecular weight of 384.25 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;phosphoric acid;7H-purin-6-amine.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;phosphoric acid;7H-purin-6-amine |
|---|---|
| PubChem CID | 172703090 |
| Molecular Formula | C10H13N10O5P |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;phosphoric acid;7H-purin-6-amine |
| SMILES | Nc1nc2nc[nH]c2c(=O)[nH]1.Nc1ncnc2nc[nH]c12.O=P(O)(O)O |
| InChI | InChI=1S/C5H5N5O.C5H5N5.H3O4P/c6-5-9-3-2(4(11)10-5)7-1-8-3;6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4/h1H,(H4,6,7,8,9,10,11);1-2H,(H3,6,7,8,9,10);(H3,1,2,3,4) |
| InChIKey | DFMNYPIRXQDTFP-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 258.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|