C5H7Cl2N5O — CID 140978979
2-amino-1,7-dihydropurin-6-one;dihydrochloride (PubChem CID 140978979) has the molecular formula C5H7Cl2N5O and a molecular weight of 224.05 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;dihydrochloride.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;dihydrochloride |
|---|---|
| PubChem CID | 140978979 |
| Molecular Formula | C5H7Cl2N5O |
| Molecular Weight | 224.05 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N5O.2ClH/c6-5-9-3-2(4(11)10-5)7-1-8-3;;/h1H,(H4,6,7,8,9,10,11);2*1H |
| InChIKey | BPVHBSUJEOMRDH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.05 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |