C17H19N5O3 — CID 136951012
3,3-dimethyl-N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenoxybutanamide (PubChem CID 136951012) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3,3-dimethyl-N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenoxybutanamide.
| Compound Name | 3,3-dimethyl-N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenoxybutanamide |
|---|---|
| PubChem CID | 136951012 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3,3-dimethyl-N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenoxybutanamide |
| SMILES | CC(C)(C)C(Oc1ccccc1)C(=O)Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H19N5O3/c1-17(2,3)12(25-10-7-5-4-6-8-10)15(24)22-16-20-13-11(14(23)21-16)18-9-19-13/h4-9,12H,1-3H3,(H3,18,19,20,21,22,23,24) |
| InChIKey | MWFNJXLGDSKQIL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |