C6H4N6OS — CID 135742599
(2-amino-6-oxo-1,7-dihydropurin-8-yl) thiocyanate (PubChem CID 135742599) has the molecular formula C6H4N6OS and a molecular weight of 208.21 g/mol. Its IUPAC name is (2-amino-6-oxo-1,7-dihydropurin-8-yl) thiocyanate.
| Compound Name | (2-amino-6-oxo-1,7-dihydropurin-8-yl) thiocyanate |
|---|---|
| PubChem CID | 135742599 |
| Molecular Formula | C6H4N6OS |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | (2-amino-6-oxo-1,7-dihydropurin-8-yl) thiocyanate |
| SMILES | N#CSc1nc2nc(N)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C6H4N6OS/c7-1-14-6-9-2-3(11-6)10-5(8)12-4(2)13/h(H4,8,9,10,11,12,13) |
| InChIKey | XMNYVEUNOUNDRW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|