C6H3N5OS — CID 136951542
(6-oxo-1,7-dihydropurin-8-yl) thiocyanate (PubChem CID 136951542) has the molecular formula C6H3N5OS and a molecular weight of 193.19 g/mol. Its IUPAC name is (6-oxo-1,7-dihydropurin-8-yl) thiocyanate.
| Compound Name | (6-oxo-1,7-dihydropurin-8-yl) thiocyanate |
|---|---|
| PubChem CID | 136951542 |
| Molecular Formula | C6H3N5OS |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | (6-oxo-1,7-dihydropurin-8-yl) thiocyanate |
| SMILES | N#CSc1nc2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C6H3N5OS/c7-1-13-6-10-3-4(11-6)8-2-9-5(3)12/h2H,(H2,8,9,10,11,12) |
| InChIKey | ZPKBKYAMTVDPEQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|