C7H9N7O — CID 137241497
8-(dimethylaminodiazenyl)-1,7-dihydropurin-6-one (PubChem CID 137241497) has the molecular formula C7H9N7O and a molecular weight of 207.20 g/mol. Its IUPAC name is 8-(dimethylaminodiazenyl)-1,7-dihydropurin-6-one.
| Compound Name | 8-(dimethylaminodiazenyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 137241497 |
| Molecular Formula | C7H9N7O |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 8-(dimethylaminodiazenyl)-1,7-dihydropurin-6-one |
| SMILES | CN(C)N=Nc1nc2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C7H9N7O/c1-14(2)13-12-7-10-4-5(11-7)8-3-9-6(4)15/h3H,1-2H3,(H2,8,9,10,11,15) |
| InChIKey | ZGUZIUAYOJECHQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|