C5H5N5O3S — CID 135422177
6-oxo-1,7-dihydropurine-8-sulfonamide (PubChem CID 135422177) has the molecular formula C5H5N5O3S and a molecular weight of 215.19 g/mol. Its IUPAC name is 6-oxo-1,7-dihydropurine-8-sulfonamide.
| Compound Name | 6-oxo-1,7-dihydropurine-8-sulfonamide |
|---|---|
| PubChem CID | 135422177 |
| Molecular Formula | C5H5N5O3S |
| Molecular Weight | 215.19 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 6-oxo-1,7-dihydropurine-8-sulfonamide |
| SMILES | NS(=O)(=O)c1nc2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C5H5N5O3S/c6-14(12,13)5-9-2-3(10-5)7-1-8-4(2)11/h1H,(H2,6,12,13)(H2,7,8,9,10,11) |
| InChIKey | GSKPJJZRRZURIE-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.19 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |