C6H3N5O — CID 135559145
6-oxo-1,7-dihydropurine-8-carbonitrile (PubChem CID 135559145) has the molecular formula C6H3N5O and a molecular weight of 161.12 g/mol. Its IUPAC name is 6-oxo-1,7-dihydropurine-8-carbonitrile.
| Compound Name | 6-oxo-1,7-dihydropurine-8-carbonitrile |
|---|---|
| PubChem CID | 135559145 |
| Molecular Formula | C6H3N5O |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 6-oxo-1,7-dihydropurine-8-carbonitrile |
| SMILES | N#Cc1nc2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C6H3N5O/c7-1-3-10-4-5(11-3)8-2-9-6(4)12/h2H,(H2,8,9,10,11,12) |
| InChIKey | CTSXTGRMWIXNJV-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |