C8H4N4O — CID 137211979
4-oxo-3H-pyrido[2,3-d]pyrimidine-2-carbonitrile (PubChem CID 137211979) has the molecular formula C8H4N4O and a molecular weight of 172.15 g/mol. Its IUPAC name is 4-oxo-3H-pyrido[2,3-d]pyrimidine-2-carbonitrile.
| Compound Name | 4-oxo-3H-pyrido[2,3-d]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 137211979 |
| Molecular Formula | C8H4N4O |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 4-oxo-3H-pyrido[2,3-d]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc2ncccc2c(=O)[nH]1 |
| InChI | InChI=1S/C8H4N4O/c9-4-6-11-7-5(8(13)12-6)2-1-3-10-7/h1-3H,(H,10,11,12,13) |
| InChIKey | WLDMOCUMBKSIOG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |