C16H15N3O3 — CID 135899320
2-(3-phenoxypropoxy)-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135899320) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(3-phenoxypropoxy)-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(3-phenoxypropoxy)-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135899320 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(3-phenoxypropoxy)-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(OCCCOc2ccccc2)nc2ncccc12 |
| InChI | InChI=1S/C16H15N3O3/c20-15-13-8-4-9-17-14(13)18-16(19-15)22-11-5-10-21-12-6-2-1-3-7-12/h1-4,6-9H,5,10-11H2,(H,17,18,19,20) |
| InChIKey | ZWKZWLYPQOHGTJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|