C20H20N2O4 — CID 135816774
[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-phenoxybutanoate (PubChem CID 135816774) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-phenoxybutanoate.
| Compound Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-phenoxybutanoate |
|---|---|
| PubChem CID | 135816774 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-phenoxybutanoate |
| SMILES | C[C@@H](OC(=O)CCCOc1ccccc1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H20N2O4/c1-14(19-21-17-11-6-5-10-16(17)20(24)22-19)26-18(23)12-7-13-25-15-8-3-2-4-9-15/h2-6,8-11,14H,7,12-13H2,1H3,(H,21,22,24)/t14-/m1/s1 |
| InChIKey | BLHAPMBKNYNPFT-CQSZACIVSA-N |
| XLogP | 3.39 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|