C16H20N2O3 — CID 135784464
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-methylpentanoate (PubChem CID 135784464) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-methylpentanoate.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-methylpentanoate |
|---|---|
| PubChem CID | 135784464 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)O[C@@H](C)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)8-9-14(19)21-11(3)15-17-13-7-5-4-6-12(13)16(20)18-15/h4-7,10-11H,8-9H2,1-3H3,(H,17,18,20)/t11-/m0/s1 |
| InChIKey | PSJQMDDXXFYLMW-NSHDSACASA-N |
| XLogP | 2.96 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |