C10H15N6O+ — CID 135832656
8-(4-methylpiperazin-4-ium-1-yl)-1,7-dihydropurin-6-one (PubChem CID 135832656) has the molecular formula C10H15N6O+ and a molecular weight of 235.27 g/mol. Its IUPAC name is 8-(4-methylpiperazin-4-ium-1-yl)-1,7-dihydropurin-6-one.
| Compound Name | 8-(4-methylpiperazin-4-ium-1-yl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135832656 |
| Molecular Formula | C10H15N6O+ |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 8-(4-methylpiperazin-4-ium-1-yl)-1,7-dihydropurin-6-one |
| SMILES | C[NH+]1CCN(c2nc3nc[nH]c(=O)c3[nH]2)CC1 |
| InChI | InChI=1S/C10H14N6O/c1-15-2-4-16(5-3-15)10-13-7-8(14-10)11-6-12-9(7)17/h6H,2-5H2,1H3,(H2,11,12,13,14,17)/p+1 |
| InChIKey | DVOUVWHIRJEKMA-UHFFFAOYSA-O |
| XLogP | -2.02 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |