C10H14ClN7O — CID 135531899
8-[[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,7-dihydropurin-6-one (PubChem CID 135531899) has the molecular formula C10H14ClN7O and a molecular weight of 283.72 g/mol. Its IUPAC name is 8-[[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,7-dihydropurin-6-one.
| Compound Name | 8-[[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135531899 |
| Molecular Formula | C10H14ClN7O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 8-[[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,7-dihydropurin-6-one |
| SMILES | CC(C)N(CCCl)N=Nc1nc2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C10H14ClN7O/c1-6(2)18(4-3-11)17-16-10-14-7-8(15-10)12-5-13-9(7)19/h5-6H,3-4H2,1-2H3,(H2,12,13,14,15,19) |
| InChIKey | OGBXWJXLHGQAMC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|