C9H12Cl2N8O — CID 135580215
2-amino-8-[(E)-bis(2-chloroethyl)aminodiazenyl]-1,7-dihydropurin-6-one (PubChem CID 135580215) has the molecular formula C9H12Cl2N8O and a molecular weight of 319.16 g/mol. Its IUPAC name is 2-amino-8-[(E)-bis(2-chloroethyl)aminodiazenyl]-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-[(E)-bis(2-chloroethyl)aminodiazenyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135580215 |
| Molecular Formula | C9H12Cl2N8O |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-amino-8-[(E)-bis(2-chloroethyl)aminodiazenyl]-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(/N=N/N(CCCl)CCCl)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C9H12Cl2N8O/c10-1-3-19(4-2-11)18-17-9-13-5-6(15-9)14-8(12)16-7(5)20/h1-4H2,(H4,12,13,14,15,16,20)/b18-17+ |
| InChIKey | ZAJPRAXGLCMMKP-ISLYRVAYSA-N |
| XLogP | 1.01 |
| TPSA | 128.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|