C13H21N7O2 — CID 137309375
8-[(E)-(dibutylamino)diazenyl]-3,7-dihydropurine-2,6-dione (PubChem CID 137309375) has the molecular formula C13H21N7O2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 8-[(E)-(dibutylamino)diazenyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[(E)-(dibutylamino)diazenyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 137309375 |
| Molecular Formula | C13H21N7O2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 8-[(E)-(dibutylamino)diazenyl]-3,7-dihydropurine-2,6-dione |
| SMILES | CCCCN(CCCC)/N=N/c1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C13H21N7O2/c1-3-5-7-20(8-6-4-2)19-18-12-14-9-10(15-12)16-13(22)17-11(9)21/h3-8H2,1-2H3,(H3,14,15,16,17,21,22)/b19-18+ |
| InChIKey | UFJFCTOHDKKNIR-VHEBQXMUSA-N |
| XLogP | 1.84 |
| TPSA | 122.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|