C8H9ClN4O2 — CID 114402437
8-(3-chloropropyl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402437) has the molecular formula C8H9ClN4O2 and a molecular weight of 228.64 g/mol. Its IUPAC name is 8-(3-chloropropyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(3-chloropropyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402437 |
| Molecular Formula | C8H9ClN4O2 |
| Molecular Weight | 228.64 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 8-(3-chloropropyl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(CCCCl)nc2[nH]1 |
| InChI | InChI=1S/C8H9ClN4O2/c9-3-1-2-4-10-5-6(11-4)12-8(15)13-7(5)14/h1-3H2,(H3,10,11,12,13,14,15) |
| InChIKey | ADQSFQYTCMDZLZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.64 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|