C14H15N5O2 — CID 114402191
8-(3-amino-3-phenylpropyl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402191) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 8-(3-amino-3-phenylpropyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(3-amino-3-phenylpropyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402191 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 8-(3-amino-3-phenylpropyl)-3,7-dihydropurine-2,6-dione |
| SMILES | NC(CCc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C14H15N5O2/c15-9(8-4-2-1-3-5-8)6-7-10-16-11-12(17-10)18-14(21)19-13(11)20/h1-5,9H,6-7,15H2,(H3,16,17,18,19,20,21) |
| InChIKey | SCMIOUVHRJPZEX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |