C12H10N4O3 — CID 114402810
8-[hydroxy(phenyl)methyl]-3,7-dihydropurine-2,6-dione (PubChem CID 114402810) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 8-[hydroxy(phenyl)methyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[hydroxy(phenyl)methyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402810 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 8-[hydroxy(phenyl)methyl]-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(C(O)c3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C12H10N4O3/c17-8(6-4-2-1-3-5-6)10-13-7-9(14-10)15-12(19)16-11(7)18/h1-5,8,17H,(H3,13,14,15,16,18,19) |
| InChIKey | XXFCSJZBNTWPGD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |