C7H8N4O3 — CID 104921170
8-[(1S)-1-hydroxyethyl]-3,7-dihydropurine-2,6-dione (PubChem CID 104921170) has the molecular formula C7H8N4O3 and a molecular weight of 196.17 g/mol. Its IUPAC name is 8-[(1S)-1-hydroxyethyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[(1S)-1-hydroxyethyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 104921170 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 8-[(1S)-1-hydroxyethyl]-3,7-dihydropurine-2,6-dione |
| SMILES | C[C@H](O)c1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C7H8N4O3/c1-2(12)4-8-3-5(9-4)10-7(14)11-6(3)13/h2,12H,1H3,(H3,8,9,10,11,13,14)/t2-/m0/s1 |
| InChIKey | BRFRCYUEPRASOC-REOHCLBHSA-N |
| XLogP | -1.01 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |