C7H9N5O2 — CID 114402270
8-(1-aminoethyl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402270) has the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. Its IUPAC name is 8-(1-aminoethyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(1-aminoethyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402270 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 8-(1-aminoethyl)-3,7-dihydropurine-2,6-dione |
| SMILES | CC(N)c1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C7H9N5O2/c1-2(8)4-9-3-5(10-4)11-7(14)12-6(3)13/h2H,8H2,1H3,(H3,9,10,11,12,13,14) |
| InChIKey | AMPJGCXXVDHGAR-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |