C8H11N5O3 — CID 107835469
8-(3-amino-1-hydroxypropyl)-3,7-dihydropurine-2,6-dione (PubChem CID 107835469) has the molecular formula C8H11N5O3 and a molecular weight of 225.21 g/mol. Its IUPAC name is 8-(3-amino-1-hydroxypropyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(3-amino-1-hydroxypropyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 107835469 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 8-(3-amino-1-hydroxypropyl)-3,7-dihydropurine-2,6-dione |
| SMILES | NCCC(O)c1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C8H11N5O3/c9-2-1-3(14)5-10-4-6(11-5)12-8(16)13-7(4)15/h3,14H,1-2,9H2,(H3,10,11,12,13,15,16) |
| InChIKey | UICIAQIWCFLVKC-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |