C9H13N5O3 — CID 103154029
8-(3-amino-2-methoxypropyl)-3,7-dihydropurine-2,6-dione (PubChem CID 103154029) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 8-(3-amino-2-methoxypropyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(3-amino-2-methoxypropyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 103154029 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 8-(3-amino-2-methoxypropyl)-3,7-dihydropurine-2,6-dione |
| SMILES | COC(CN)Cc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C9H13N5O3/c1-17-4(3-10)2-5-11-6-7(12-5)13-9(16)14-8(6)15/h4H,2-3,10H2,1H3,(H3,11,12,13,14,15,16) |
| InChIKey | GDGUIAZDVGZDQL-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |