C8H8N4O4S — CID 114401858
2-[(2,6-dioxo-3,7-dihydropurin-8-yl)methylsulfanyl]acetic acid (PubChem CID 114401858) has the molecular formula C8H8N4O4S and a molecular weight of 256.24 g/mol. Its IUPAC name is 2-[(2,6-dioxo-3,7-dihydropurin-8-yl)methylsulfanyl]acetic acid.
| Compound Name | 2-[(2,6-dioxo-3,7-dihydropurin-8-yl)methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 114401858 |
| Molecular Formula | C8H8N4O4S |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-[(2,6-dioxo-3,7-dihydropurin-8-yl)methylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C8H8N4O4S/c13-4(14)2-17-1-3-9-5-6(10-3)11-8(16)12-7(5)15/h1-2H2,(H,13,14)(H3,9,10,11,12,15,16) |
| InChIKey | NTGIBCCTQJPACI-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |