C12H11N5O3 — CID 114402204
8-[(4-hydroxyanilino)methyl]-3,7-dihydropurine-2,6-dione (PubChem CID 114402204) has the molecular formula C12H11N5O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is 8-[(4-hydroxyanilino)methyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[(4-hydroxyanilino)methyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402204 |
| Molecular Formula | C12H11N5O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 8-[(4-hydroxyanilino)methyl]-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(CNc3ccc(O)cc3)nc2[nH]1 |
| InChI | InChI=1S/C12H11N5O3/c18-7-3-1-6(2-4-7)13-5-8-14-9-10(15-8)16-12(20)17-11(9)19/h1-4,13,18H,5H2,(H3,14,15,16,17,19,20) |
| InChIKey | NPCILAZRLZDTRT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|