C19H13ClN4O3 — CID 67651496
8-[[4-(4-chlorobenzoyl)phenyl]methyl]-3,7-dihydropurine-2,6-dione (PubChem CID 67651496) has the molecular formula C19H13ClN4O3 and a molecular weight of 380.79 g/mol. Its IUPAC name is 8-[[4-(4-chlorobenzoyl)phenyl]methyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[[4-(4-chlorobenzoyl)phenyl]methyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 67651496 |
| Molecular Formula | C19H13ClN4O3 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 8-[[4-(4-chlorobenzoyl)phenyl]methyl]-3,7-dihydropurine-2,6-dione |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc(Cc2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)cc1 |
| InChI | InChI=1S/C19H13ClN4O3/c20-13-7-5-12(6-8-13)16(25)11-3-1-10(2-4-11)9-14-21-15-17(22-14)23-19(27)24-18(15)26/h1-8H,9H2,(H3,21,22,23,24,26,27) |
| InChIKey | SOWSCLJNSFVXEF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |