C8H11ClN4O2 — CID 162308882
8-propyl-3,7-dihydropurine-2,6-dione;hydrochloride (PubChem CID 162308882) has the molecular formula C8H11ClN4O2 and a molecular weight of 230.65 g/mol. Its IUPAC name is 8-propyl-3,7-dihydropurine-2,6-dione;hydrochloride.
| Compound Name | 8-propyl-3,7-dihydropurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 162308882 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 8-propyl-3,7-dihydropurine-2,6-dione;hydrochloride |
| SMILES | CCCc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1.Cl |
| InChI | InChI=1S/C8H10N4O2.ClH/c1-2-3-4-9-5-6(10-4)11-8(14)12-7(5)13;/h2-3H2,1H3,(H3,9,10,11,12,13,14);1H |
| InChIKey | SLTXPZSFBABNKP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |