C13H13N5O2 — CID 114402262
8-[2-(3-aminophenyl)ethyl]-3,7-dihydropurine-2,6-dione (PubChem CID 114402262) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 8-[2-(3-aminophenyl)ethyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[2-(3-aminophenyl)ethyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402262 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 8-[2-(3-aminophenyl)ethyl]-3,7-dihydropurine-2,6-dione |
| SMILES | Nc1cccc(CCc2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)c1 |
| InChI | InChI=1S/C13H13N5O2/c14-8-3-1-2-7(6-8)4-5-9-15-10-11(16-9)17-13(20)18-12(10)19/h1-3,6H,4-5,14H2,(H3,15,16,17,18,19,20) |
| InChIKey | AEVSYTYCNQMEST-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|