C15H15ClN3- — CID 43829289
3-[2-(1H-benzimidazol-2-yl)ethyl]aniline chloride (PubChem CID 43829289) has the molecular formula C15H15ClN3- and a molecular weight of 272.76 g/mol. Its IUPAC name is 3-[2-(1H-benzimidazol-2-yl)ethyl]aniline chloride.
| Compound Name | 3-[2-(1H-benzimidazol-2-yl)ethyl]aniline chloride |
|---|---|
| PubChem CID | 43829289 |
| Molecular Formula | C15H15ClN3- |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[2-(1H-benzimidazol-2-yl)ethyl]aniline chloride |
| SMILES | Nc1cccc(CCc2nc3ccccc3[nH]2)c1.[Cl-] |
| InChI | InChI=1S/C15H15N3.ClH/c16-12-5-3-4-11(10-12)8-9-15-17-13-6-1-2-7-14(13)18-15;/h1-7,10H,8-9,16H2,(H,17,18);1H/p-1 |
| InChIKey | DLRMTDNHYVWZEP-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|