C12H9ClN4O2 — CID 114402436
8-[3-(chloromethyl)phenyl]-3,7-dihydropurine-2,6-dione (PubChem CID 114402436) has the molecular formula C12H9ClN4O2 and a molecular weight of 276.68 g/mol. Its IUPAC name is 8-[3-(chloromethyl)phenyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[3-(chloromethyl)phenyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402436 |
| Molecular Formula | C12H9ClN4O2 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 8-[3-(chloromethyl)phenyl]-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3cccc(CCl)c3)nc2[nH]1 |
| InChI | InChI=1S/C12H9ClN4O2/c13-5-6-2-1-3-7(4-6)9-14-8-10(15-9)16-12(19)17-11(8)18/h1-4H,5H2,(H3,14,15,16,17,18,19) |
| InChIKey | DTPIDCHMJDWODG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|