C19H17N5O — CID 123446837
5-(3-aminophenyl)-6-(2-phenylethyl)-1,3-dihydroimidazo[4,5-b]pyrazin-2-one (PubChem CID 123446837) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-(3-aminophenyl)-6-(2-phenylethyl)-1,3-dihydroimidazo[4,5-b]pyrazin-2-one.
| Compound Name | 5-(3-aminophenyl)-6-(2-phenylethyl)-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 123446837 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 5-(3-aminophenyl)-6-(2-phenylethyl)-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| SMILES | Nc1cccc(-c2nc3[nH]c(=O)[nH]c3nc2CCc2ccccc2)c1 |
| InChI | InChI=1S/C19H17N5O/c20-14-8-4-7-13(11-14)16-15(10-9-12-5-2-1-3-6-12)21-17-18(22-16)24-19(25)23-17/h1-8,11H,9-10,20H2,(H2,21,22,23,24,25) |
| InChIKey | XMUJRGQFSPLGTO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|