C9H12N4O3 — CID 114403027
8-(propan-2-yloxymethyl)-3,7-dihydropurine-2,6-dione (PubChem CID 114403027) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 8-(propan-2-yloxymethyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(propan-2-yloxymethyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114403027 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 8-(propan-2-yloxymethyl)-3,7-dihydropurine-2,6-dione |
| SMILES | CC(C)OCc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C9H12N4O3/c1-4(2)16-3-5-10-6-7(11-5)12-9(15)13-8(6)14/h4H,3H2,1-2H3,(H3,10,11,12,13,14,15) |
| InChIKey | RDMBMPYZOGUHJM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |