C13H16N4O4 — CID 114401863
2-[1-[(2,6-dioxo-3,7-dihydropurin-8-yl)methyl]cyclopentyl]acetic acid (PubChem CID 114401863) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-[1-[(2,6-dioxo-3,7-dihydropurin-8-yl)methyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[(2,6-dioxo-3,7-dihydropurin-8-yl)methyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 114401863 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[1-[(2,6-dioxo-3,7-dihydropurin-8-yl)methyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(Cc2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)CCCC1 |
| InChI | InChI=1S/C13H16N4O4/c18-8(19)6-13(3-1-2-4-13)5-7-14-9-10(15-7)16-12(21)17-11(9)20/h1-6H2,(H,18,19)(H3,14,15,16,17,20,21) |
| InChIKey | QEJAVBXHZSRADM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |