C10H15N5O2 — CID 114402395
8-(1-aminopentyl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402395) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 8-(1-aminopentyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(1-aminopentyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402395 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 8-(1-aminopentyl)-3,7-dihydropurine-2,6-dione |
| SMILES | CCCCC(N)c1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C10H15N5O2/c1-2-3-4-5(11)7-12-6-8(13-7)14-10(17)15-9(6)16/h5H,2-4,11H2,1H3,(H3,12,13,14,15,16,17) |
| InChIKey | IFZJPRTVABMEKQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |