C12H17N3 — CID 27506225
(1R)-1-(1H-benzimidazol-2-yl)pentan-1-amine (PubChem CID 27506225) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is (1R)-1-(1H-benzimidazol-2-yl)pentan-1-amine.
| Compound Name | (1R)-1-(1H-benzimidazol-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 27506225 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (1R)-1-(1H-benzimidazol-2-yl)pentan-1-amine |
| SMILES | CCCC[C@@H](N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H17N3/c1-2-3-6-9(13)12-14-10-7-4-5-8-11(10)15-12/h4-5,7-9H,2-3,6,13H2,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | UJHPABYZJRSRMS-SECBINFHSA-N |
| XLogP | 2.75 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |